C24H20Cl2N3O3+ — CID 126067054
N-[(1Z,4S,5S)-1-[(2,4-dichlorophenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-4-methoxybenzamide (PubChem CID 126067054) has the molecular formula C24H20Cl2N3O3+ and a molecular weight of 469.35 g/mol. Its IUPAC name is N-[(1Z,4S,5S)-1-[(2,4-dichlorophenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-4-methoxybenzamide.
| Compound Name | N-[(1Z,4S,5S)-1-[(2,4-dichlorophenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 126067054 |
| Molecular Formula | C24H20Cl2N3O3+ |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | N-[(1Z,4S,5S)-1-[(2,4-dichlorophenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2C(=O)N/[N+](=C\c3ccc(Cl)cc3Cl)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19Cl2N3O3/c1-32-19-11-8-16(9-12-19)23(30)27-21-22(15-5-3-2-4-6-15)29(28-24(21)31)14-17-7-10-18(25)13-20(17)26/h2-14,21-22H,1H3,(H-,27,28,30,31)/p+1/b29-14-/t21-,22-/m0/s1 |
| InChIKey | SMKACECABMCMSC-GWLUTCJNSA-O |
| XLogP | 4.02 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|