C24H20Cl2N3O2+ — CID 126066925
N-[(1Z,4S,5R)-1-[(2,4-dichlorophenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide (PubChem CID 126066925) has the molecular formula C24H20Cl2N3O2+ and a molecular weight of 453.35 g/mol. Its IUPAC name is N-[(1Z,4S,5R)-1-[(2,4-dichlorophenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide.
| Compound Name | N-[(1Z,4S,5R)-1-[(2,4-dichlorophenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 126066925 |
| Molecular Formula | C24H20Cl2N3O2+ |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | N-[(1Z,4S,5R)-1-[(2,4-dichlorophenyl)methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N[C@@H]2C(=O)N/[N+](=C\c3ccc(Cl)cc3Cl)[C@@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C24H19Cl2N3O2/c1-15-6-5-9-17(12-15)23(30)27-21-22(16-7-3-2-4-8-16)29(28-24(21)31)14-18-10-11-19(25)13-20(18)26/h2-14,21-22H,1H3,(H-,27,28,30,31)/p+1/b29-14-/t21-,22+/m0/s1 |
| InChIKey | XCAQAIFGSBDVJR-NGTVUAHZSA-O |
| XLogP | 4.32 |
| TPSA | 61.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|