C24H19Cl3N3O2+ — CID 126063386
N-[(1Z,4R,5R)-5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide (PubChem CID 126063386) has the molecular formula C24H19Cl3N3O2+ and a molecular weight of 487.79 g/mol. Its IUPAC name is N-[(1Z,4R,5R)-5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide.
| Compound Name | N-[(1Z,4R,5R)-5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 126063386 |
| Molecular Formula | C24H19Cl3N3O2+ |
| Molecular Weight | 487.79 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | N-[(1Z,4R,5R)-5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N[C@H]2C(=O)N/[N+](=C\c3ccc(Cl)cc3Cl)[C@@H]2c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H18Cl3N3O2/c1-14-3-2-4-16(11-14)23(31)28-21-22(15-5-8-18(25)9-6-15)30(29-24(21)32)13-17-7-10-19(26)12-20(17)27/h2-13,21-22H,1H3,(H-,28,29,31,32)/p+1/b30-13-/t21-,22-/m1/s1 |
| InChIKey | FXLXEVOROJPPCQ-YIGBJAPESA-O |
| XLogP | 4.97 |
| TPSA | 61.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.79 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|