C28H30ClN4O2+ — CID 126057933
N-[(1Z,4S,5S)-5-(4-chlorophenyl)-1-[[4-(diethylamino)phenyl]methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide (PubChem CID 126057933) has the molecular formula C28H30ClN4O2+ and a molecular weight of 490.03 g/mol. Its IUPAC name is N-[(1Z,4S,5S)-5-(4-chlorophenyl)-1-[[4-(diethylamino)phenyl]methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide.
| Compound Name | N-[(1Z,4S,5S)-5-(4-chlorophenyl)-1-[[4-(diethylamino)phenyl]methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 126057933 |
| Molecular Formula | C28H30ClN4O2+ |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | N-[(1Z,4S,5S)-5-(4-chlorophenyl)-1-[[4-(diethylamino)phenyl]methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide |
| SMILES | CCN(CC)c1ccc(/C=[N+]2\NC(=O)[C@@H](NC(=O)c3cccc(C)c3)[C@@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H29ClN4O2/c1-4-32(5-2)24-15-9-20(10-16-24)18-33-26(21-11-13-23(29)14-12-21)25(28(35)31-33)30-27(34)22-8-6-7-19(3)17-22/h6-18,25-26H,4-5H2,1-3H3,(H-,30,31,34,35)/p+1/t25-,26-/m0/s1 |
| InChIKey | ANVABNIGVTUTOD-UIOOFZCWSA-O |
| XLogP | 4.51 |
| TPSA | 64.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|