C26H27N4O2+ — CID 126066982
N-[(1Z,4R,5S)-1-[[4-(dimethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide (PubChem CID 126066982) has the molecular formula C26H27N4O2+ and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[(1Z,4R,5S)-1-[[4-(dimethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide.
| Compound Name | N-[(1Z,4R,5S)-1-[[4-(dimethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 126066982 |
| Molecular Formula | C26H27N4O2+ |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | N-[(1Z,4R,5S)-1-[[4-(dimethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N[C@H]2C(=O)N/[N+](=C\c3ccc(N(C)C)cc3)[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C26H26N4O2/c1-18-8-7-11-21(16-18)25(31)27-23-24(20-9-5-4-6-10-20)30(28-26(23)32)17-19-12-14-22(15-13-19)29(2)3/h4-17,23-24H,1-3H3,(H-,27,28,31,32)/p+1/t23-,24+/m1/s1 |
| InChIKey | VAUVGCYZWPQCJF-RPWUZVMVSA-O |
| XLogP | 3.08 |
| TPSA | 64.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|