C25H24ClN4O2+ — CID 126079059
4-chloro-N-[(1Z,4S,5S)-1-[[4-(dimethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]benzamide (PubChem CID 126079059) has the molecular formula C25H24ClN4O2+ and a molecular weight of 447.95 g/mol. Its IUPAC name is 4-chloro-N-[(1Z,4S,5S)-1-[[4-(dimethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]benzamide.
| Compound Name | 4-chloro-N-[(1Z,4S,5S)-1-[[4-(dimethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]benzamide |
|---|---|
| PubChem CID | 126079059 |
| Molecular Formula | C25H24ClN4O2+ |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 4-chloro-N-[(1Z,4S,5S)-1-[[4-(dimethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]benzamide |
| SMILES | CN(C)c1ccc(/C=[N+]2\NC(=O)[C@@H](NC(=O)c3ccc(Cl)cc3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23ClN4O2/c1-29(2)21-14-8-17(9-15-21)16-30-23(18-6-4-3-5-7-18)22(25(32)28-30)27-24(31)19-10-12-20(26)13-11-19/h3-16,22-23H,1-2H3,(H-,27,28,31,32)/p+1/t22-,23-/m0/s1 |
| InChIKey | RTKQCWWAWJSANY-GOTSBHOMSA-O |
| XLogP | 3.42 |
| TPSA | 64.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|