C26H26ClN4O2+ — CID 126068511
N-[(1Z,4S,5R)-5-(4-chlorophenyl)-1-[[4-(dimethylamino)phenyl]methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide (PubChem CID 126068511) has the molecular formula C26H26ClN4O2+ and a molecular weight of 461.97 g/mol. Its IUPAC name is N-[(1Z,4S,5R)-5-(4-chlorophenyl)-1-[[4-(dimethylamino)phenyl]methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide.
| Compound Name | N-[(1Z,4S,5R)-5-(4-chlorophenyl)-1-[[4-(dimethylamino)phenyl]methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 126068511 |
| Molecular Formula | C26H26ClN4O2+ |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-[(1Z,4S,5R)-5-(4-chlorophenyl)-1-[[4-(dimethylamino)phenyl]methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N[C@@H]2C(=O)N/[N+](=C\c3ccc(N(C)C)cc3)[C@@H]2c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C26H25ClN4O2/c1-17-5-4-6-20(15-17)25(32)28-23-24(19-9-11-21(27)12-10-19)31(29-26(23)33)16-18-7-13-22(14-8-18)30(2)3/h4-16,23-24H,1-3H3,(H-,28,29,32,33)/p+1/t23-,24+/m0/s1 |
| InChIKey | OEVWNXDRBUSJIG-BJKOFHAPSA-O |
| XLogP | 3.73 |
| TPSA | 64.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|