C28H31N4O2+ — CID 126065973
N-[(1Z,4R,5S)-1-[[4-(diethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide (PubChem CID 126065973) has the molecular formula C28H31N4O2+ and a molecular weight of 455.58 g/mol. Its IUPAC name is N-[(1Z,4R,5S)-1-[[4-(diethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide.
| Compound Name | N-[(1Z,4R,5S)-1-[[4-(diethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 126065973 |
| Molecular Formula | C28H31N4O2+ |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | N-[(1Z,4R,5S)-1-[[4-(diethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-3-methylbenzamide |
| SMILES | CCN(CC)c1ccc(/C=[N+]2\NC(=O)[C@H](NC(=O)c3cccc(C)c3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N4O2/c1-4-31(5-2)24-16-14-21(15-17-24)19-32-26(22-11-7-6-8-12-22)25(28(34)30-32)29-27(33)23-13-9-10-20(3)18-23/h6-19,25-26H,4-5H2,1-3H3,(H-,29,30,33,34)/p+1/t25-,26+/m1/s1 |
| InChIKey | SFORDMNDNDEOQY-FTJBHMTQSA-O |
| XLogP | 3.86 |
| TPSA | 64.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|