C28H31N4O3+ — CID 126059098
N-[(1Z,4S,5S)-1-[[4-(diethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-4-methoxybenzamide (PubChem CID 126059098) has the molecular formula C28H31N4O3+ and a molecular weight of 471.58 g/mol. Its IUPAC name is N-[(1Z,4S,5S)-1-[[4-(diethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-4-methoxybenzamide.
| Compound Name | N-[(1Z,4S,5S)-1-[[4-(diethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 126059098 |
| Molecular Formula | C28H31N4O3+ |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-[(1Z,4S,5S)-1-[[4-(diethylamino)phenyl]methylidene]-3-oxo-5-phenylpyrazolidin-1-ium-4-yl]-4-methoxybenzamide |
| SMILES | CCN(CC)c1ccc(/C=[N+]2\NC(=O)[C@@H](NC(=O)c3ccc(OC)cc3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N4O3/c1-4-31(5-2)23-15-11-20(12-16-23)19-32-26(21-9-7-6-8-10-21)25(28(34)30-32)29-27(33)22-13-17-24(35-3)18-14-22/h6-19,25-26H,4-5H2,1-3H3,(H-,29,30,33,34)/p+1/t25-,26-/m0/s1 |
| InChIKey | HRXCOOOFRPFZNI-UIOOFZCWSA-O |
| XLogP | 3.56 |
| TPSA | 73.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|