C27H28N3O5+ — CID 126067099
N-[(1Z,4R,5R)-1-[(4-ethoxyphenyl)methylidene]-5-(4-methoxyphenyl)-3-oxopyrazolidin-1-ium-4-yl]-4-methoxybenzamide (PubChem CID 126067099) has the molecular formula C27H28N3O5+ and a molecular weight of 474.54 g/mol. Its IUPAC name is N-[(1Z,4R,5R)-1-[(4-ethoxyphenyl)methylidene]-5-(4-methoxyphenyl)-3-oxopyrazolidin-1-ium-4-yl]-4-methoxybenzamide.
| Compound Name | N-[(1Z,4R,5R)-1-[(4-ethoxyphenyl)methylidene]-5-(4-methoxyphenyl)-3-oxopyrazolidin-1-ium-4-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 126067099 |
| Molecular Formula | C27H28N3O5+ |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | N-[(1Z,4R,5R)-1-[(4-ethoxyphenyl)methylidene]-5-(4-methoxyphenyl)-3-oxopyrazolidin-1-ium-4-yl]-4-methoxybenzamide |
| SMILES | CCOc1ccc(/C=[N+]2\NC(=O)[C@H](NC(=O)c3ccc(OC)cc3)[C@H]2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H27N3O5/c1-4-35-23-11-5-18(6-12-23)17-30-25(19-7-13-21(33-2)14-8-19)24(27(32)29-30)28-26(31)20-9-15-22(34-3)16-10-20/h5-17,24-25H,4H2,1-3H3,(H-,28,29,31,32)/p+1/b30-17-/t24-,25-/m1/s1 |
| InChIKey | UIDMFHDYORMPDN-DLPRSZHDSA-O |
| XLogP | 3.12 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|