C27H28N3O4+ — CID 126059132
N-[(1Z,4S,5R)-1-[(4-ethoxyphenyl)methylidene]-5-(4-methoxyphenyl)-3-oxopyrazolidin-1-ium-4-yl]-4-methylbenzamide (PubChem CID 126059132) has the molecular formula C27H28N3O4+ and a molecular weight of 458.54 g/mol. Its IUPAC name is N-[(1Z,4S,5R)-1-[(4-ethoxyphenyl)methylidene]-5-(4-methoxyphenyl)-3-oxopyrazolidin-1-ium-4-yl]-4-methylbenzamide.
| Compound Name | N-[(1Z,4S,5R)-1-[(4-ethoxyphenyl)methylidene]-5-(4-methoxyphenyl)-3-oxopyrazolidin-1-ium-4-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 126059132 |
| Molecular Formula | C27H28N3O4+ |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | N-[(1Z,4S,5R)-1-[(4-ethoxyphenyl)methylidene]-5-(4-methoxyphenyl)-3-oxopyrazolidin-1-ium-4-yl]-4-methylbenzamide |
| SMILES | CCOc1ccc(/C=[N+]2\NC(=O)[C@@H](NC(=O)c3ccc(C)cc3)[C@H]2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H27N3O4/c1-4-34-23-13-7-19(8-14-23)17-30-25(20-11-15-22(33-3)16-12-20)24(27(32)29-30)28-26(31)21-9-5-18(2)6-10-21/h5-17,24-25H,4H2,1-3H3,(H-,28,29,31,32)/p+1/b30-17-/t24-,25+/m0/s1 |
| InChIKey | HXMWHTBRFNSQKM-HCOVDNQSSA-O |
| XLogP | 3.42 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|