C28H30N3O3+ — CID 126068614
4-methoxy-N-[(1Z,4R,5R)-5-(4-methylphenyl)-3-oxo-1-[(4-propan-2-ylphenyl)methylidene]pyrazolidin-1-ium-4-yl]benzamide (PubChem CID 126068614) has the molecular formula C28H30N3O3+ and a molecular weight of 456.57 g/mol. Its IUPAC name is 4-methoxy-N-[(1Z,4R,5R)-5-(4-methylphenyl)-3-oxo-1-[(4-propan-2-ylphenyl)methylidene]pyrazolidin-1-ium-4-yl]benzamide.
| Compound Name | 4-methoxy-N-[(1Z,4R,5R)-5-(4-methylphenyl)-3-oxo-1-[(4-propan-2-ylphenyl)methylidene]pyrazolidin-1-ium-4-yl]benzamide |
|---|---|
| PubChem CID | 126068614 |
| Molecular Formula | C28H30N3O3+ |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 4-methoxy-N-[(1Z,4R,5R)-5-(4-methylphenyl)-3-oxo-1-[(4-propan-2-ylphenyl)methylidene]pyrazolidin-1-ium-4-yl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@H]2C(=O)N/[N+](=C\c3ccc(C(C)C)cc3)[C@@H]2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H29N3O3/c1-18(2)21-11-7-20(8-12-21)17-31-26(22-9-5-19(3)6-10-22)25(28(33)30-31)29-27(32)23-13-15-24(34-4)16-14-23/h5-18,25-26H,1-4H3,(H-,29,30,32,33)/p+1/b31-17-/t25-,26-/m1/s1 |
| InChIKey | QEPVIGHQQNJYEM-PUOSSFLQSA-O |
| XLogP | 4.14 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|