C24H20ClFN3O2+ — CID 126080159
N-[(1Z,4R,5S)-5-(4-chlorophenyl)-1-[(4-fluorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide (PubChem CID 126080159) has the molecular formula C24H20ClFN3O2+ and a molecular weight of 436.89 g/mol. Its IUPAC name is N-[(1Z,4R,5S)-5-(4-chlorophenyl)-1-[(4-fluorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide.
| Compound Name | N-[(1Z,4R,5S)-5-(4-chlorophenyl)-1-[(4-fluorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 126080159 |
| Molecular Formula | C24H20ClFN3O2+ |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N-[(1Z,4R,5S)-5-(4-chlorophenyl)-1-[(4-fluorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N[C@H]2C(=O)N/[N+](=C\c3ccc(F)cc3)[C@H]2c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H19ClFN3O2/c1-15-3-2-4-18(13-15)23(30)27-21-22(17-7-9-19(25)10-8-17)29(28-24(21)31)14-16-5-11-20(26)12-6-16/h2-14,21-22H,1H3,(H-,27,28,30,31)/p+1/b29-14-/t21-,22+/m1/s1 |
| InChIKey | TUNJUACKVGHJOB-VTPLCQIWSA-O |
| XLogP | 3.80 |
| TPSA | 61.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|