C23H16Cl4N3O2+ — CID 126061602
4-chloro-N-[(1Z,4R,5S)-5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]benzamide (PubChem CID 126061602) has the molecular formula C23H16Cl4N3O2+ and a molecular weight of 508.21 g/mol. Its IUPAC name is 4-chloro-N-[(1Z,4R,5S)-5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]benzamide.
| Compound Name | 4-chloro-N-[(1Z,4R,5S)-5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]benzamide |
|---|---|
| PubChem CID | 126061602 |
| Molecular Formula | C23H16Cl4N3O2+ |
| Molecular Weight | 508.21 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | 4-chloro-N-[(1Z,4R,5S)-5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]benzamide |
| SMILES | O=C(N[C@H]1C(=O)N/[N+](=C\c2ccc(Cl)cc2Cl)[C@H]1c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H15Cl4N3O2/c24-16-6-1-13(2-7-16)21-20(28-22(31)14-3-8-17(25)9-4-14)23(32)29-30(21)12-15-5-10-18(26)11-19(15)27/h1-12,20-21H,(H-,28,29,31,32)/p+1/b30-12-/t20-,21+/m1/s1 |
| InChIKey | KLDWYVOTAXIQIQ-RYYIMKFMSA-O |
| XLogP | 5.32 |
| TPSA | 61.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.21 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|