C23H17Cl3N3O2+ — CID 126081538
N-[(1Z,4S,5S)-5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]benzamide (PubChem CID 126081538) has the molecular formula C23H17Cl3N3O2+ and a molecular weight of 473.77 g/mol. Its IUPAC name is N-[(1Z,4S,5S)-5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]benzamide.
| Compound Name | N-[(1Z,4S,5S)-5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]benzamide |
|---|---|
| PubChem CID | 126081538 |
| Molecular Formula | C23H17Cl3N3O2+ |
| Molecular Weight | 473.77 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | N-[(1Z,4S,5S)-5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methylidene]-3-oxopyrazolidin-1-ium-4-yl]benzamide |
| SMILES | O=C(N[C@@H]1C(=O)N/[N+](=C\c2ccc(Cl)cc2Cl)[C@H]1c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H16Cl3N3O2/c24-17-9-6-14(7-10-17)21-20(27-22(30)15-4-2-1-3-5-15)23(31)28-29(21)13-16-8-11-18(25)12-19(16)26/h1-13,20-21H,(H-,27,28,30,31)/p+1/b29-13-/t20-,21-/m0/s1 |
| InChIKey | WXVGWDRYLDZAHH-ZMAOBILYSA-O |
| XLogP | 4.66 |
| TPSA | 61.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.77 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|