C23H23ClN2O7S2 — CID 23239070
N-[(5S,6S)-6-(4-chlorophenyl)-4-oxo-2-sulfanylidene-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazinan-5-yl]benzamide (PubChem CID 23239070) has the molecular formula C23H23ClN2O7S2 and a molecular weight of 539.03 g/mol. Its IUPAC name is N-[(5S,6S)-6-(4-chlorophenyl)-4-oxo-2-sulfanylidene-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazinan-5-yl]benzamide.
| Compound Name | N-[(5S,6S)-6-(4-chlorophenyl)-4-oxo-2-sulfanylidene-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazinan-5-yl]benzamide |
|---|---|
| PubChem CID | 23239070 |
| Molecular Formula | C23H23ClN2O7S2 |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | N-[(5S,6S)-6-(4-chlorophenyl)-4-oxo-2-sulfanylidene-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazinan-5-yl]benzamide |
| SMILES | O=C(N[C@H]1C(=O)N([C@@H]2O[C@H](CO)[C@@H](O)C(O)[C@H]2O)C(=S)S[C@H]1c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H23ClN2O7S2/c24-13-8-6-11(7-9-13)19-15(25-20(31)12-4-2-1-3-5-12)21(32)26(23(34)35-19)22-18(30)17(29)16(28)14(10-27)33-22/h1-9,14-19,22,27-30H,10H2,(H,25,31)/t14-,15-,16-,17?,18-,19+,22-/m1/s1 |
| InChIKey | MRDVBDLIVAKUBW-UFECJKDASA-N |
| XLogP | 0.84 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|