C22H21ClN2O6S — CID 45257670
N-[4-(4-chlorophenyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazol-2-ylidene]benzamide (PubChem CID 45257670) has the molecular formula C22H21ClN2O6S and a molecular weight of 476.94 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazol-2-ylidene]benzamide.
| Compound Name | N-[4-(4-chlorophenyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 45257670 |
| Molecular Formula | C22H21ClN2O6S |
| Molecular Weight | 476.94 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | N-[4-(4-chlorophenyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazol-2-ylidene]benzamide |
| SMILES | O=C(/N=c1\scc(-c2ccc(Cl)cc2)n1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C22H21ClN2O6S/c23-14-8-6-12(7-9-14)15-11-32-22(24-20(30)13-4-2-1-3-5-13)25(15)21-19(29)18(28)17(27)16(10-26)31-21/h1-9,11,16-19,21,26-29H,10H2/b24-22-/t16-,17-,18+,19-,21-/m1/s1 |
| InChIKey | GSCGYNUXSKVBKT-NNNICSEDSA-N |
| XLogP | 1.58 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.94 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|