C16H19N3O8S2 — CID 15280195
(5S,6S)-5-amino-6-(4-nitrophenyl)-2-sulfanylidene-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazinan-4-one (PubChem CID 15280195) has the molecular formula C16H19N3O8S2 and a molecular weight of 445.48 g/mol. Its IUPAC name is (5S,6S)-5-amino-6-(4-nitrophenyl)-2-sulfanylidene-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazinan-4-one.
| Compound Name | (5S,6S)-5-amino-6-(4-nitrophenyl)-2-sulfanylidene-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 15280195 |
| Molecular Formula | C16H19N3O8S2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | (5S,6S)-5-amino-6-(4-nitrophenyl)-2-sulfanylidene-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazinan-4-one |
| SMILES | N[C@H]1C(=O)N([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=S)S[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H19N3O8S2/c17-9-13(6-1-3-7(4-2-6)19(25)26)29-16(28)18(14(9)24)15-12(23)11(22)10(21)8(5-20)27-15/h1-4,8-13,15,20-23H,5,17H2/t8-,9-,10-,11+,12-,13+,15-/m1/s1 |
| InChIKey | FWYXFJLPYDNALE-HTXOZCRQSA-N |
| XLogP | -1.38 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|