C28H26N4O5S — CID 10506392
2-[[2-[[(5R,6R)-5-benzamido-4-oxo-3,6-diphenyl-1,3-thiazinan-2-ylidene]amino]acetyl]amino]propanoic acid (PubChem CID 10506392) has the molecular formula C28H26N4O5S and a molecular weight of 530.61 g/mol. Its IUPAC name is 2-[[2-[[(5R,6R)-5-benzamido-4-oxo-3,6-diphenyl-1,3-thiazinan-2-ylidene]amino]acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[(5R,6R)-5-benzamido-4-oxo-3,6-diphenyl-1,3-thiazinan-2-ylidene]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10506392 |
| Molecular Formula | C28H26N4O5S |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 2-[[2-[[(5R,6R)-5-benzamido-4-oxo-3,6-diphenyl-1,3-thiazinan-2-ylidene]amino]acetyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C/N=C1\S[C@H](c2ccccc2)[C@H](NC(=O)c2ccccc2)C(=O)N1c1ccccc1)C(=O)O |
| InChI | InChI=1S/C28H26N4O5S/c1-18(27(36)37)30-22(33)17-29-28-32(21-15-9-4-10-16-21)26(35)23(24(38-28)19-11-5-2-6-12-19)31-25(34)20-13-7-3-8-14-20/h2-16,18,23-24H,17H2,1H3,(H,30,33)(H,31,34)(H,36,37)/b29-28-/t18?,23-,24+/m0/s1 |
| InChIKey | WXYYWDHVJMDOPE-QGCAGIPDSA-N |
| XLogP | 3.25 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|