C25H23N3O2S2 — CID 15681514
N-[(5R,6R)-6-[4-(dimethylamino)phenyl]-4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazinan-5-yl]benzamide (PubChem CID 15681514) has the molecular formula C25H23N3O2S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is N-[(5R,6R)-6-[4-(dimethylamino)phenyl]-4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazinan-5-yl]benzamide.
| Compound Name | N-[(5R,6R)-6-[4-(dimethylamino)phenyl]-4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazinan-5-yl]benzamide |
|---|---|
| PubChem CID | 15681514 |
| Molecular Formula | C25H23N3O2S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N-[(5R,6R)-6-[4-(dimethylamino)phenyl]-4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazinan-5-yl]benzamide |
| SMILES | CN(C)c1ccc([C@H]2SC(=S)N(c3ccccc3)C(=O)[C@H]2NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N3O2S2/c1-27(2)19-15-13-17(14-16-19)22-21(26-23(29)18-9-5-3-6-10-18)24(30)28(25(31)32-22)20-11-7-4-8-12-20/h3-16,21-22H,1-2H3,(H,26,29)/t21-,22+/m0/s1 |
| InChIKey | UNLAKHVMQUEMPH-FCHUYYIVSA-N |
| XLogP | 4.66 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|