C16H17NO6S2 — CID 56963724
(5Z)-5-benzylidene-2-sulfanylidene-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazolidin-4-one (PubChem CID 56963724) has the molecular formula C16H17NO6S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is (5Z)-5-benzylidene-2-sulfanylidene-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-benzylidene-2-sulfanylidene-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 56963724 |
| Molecular Formula | C16H17NO6S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | (5Z)-5-benzylidene-2-sulfanylidene-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccccc2)SC(=S)N1[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H17NO6S2/c18-7-9-11(19)12(20)13(21)15(23-9)17-14(22)10(25-16(17)24)6-8-4-2-1-3-5-8/h1-6,9,11-13,15,18-21H,7H2/b10-6-/t9-,11+,12+,13-,15-/m1/s1 |
| InChIKey | ZCYBHXIIHMGYMO-YILAHSASSA-N |
| XLogP | -0.31 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|