C14H16N2O8 — CID 177486443
(5E)-5-(furan-2-ylmethylidene)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]imidazolidine-2,4-dione (PubChem CID 177486443) has the molecular formula C14H16N2O8 and a molecular weight of 340.29 g/mol. Its IUPAC name is (5E)-5-(furan-2-ylmethylidene)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-(furan-2-ylmethylidene)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 177486443 |
| Molecular Formula | C14H16N2O8 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (5E)-5-(furan-2-ylmethylidene)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2ccco2)C(=O)N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H16N2O8/c17-5-8-9(18)10(19)11(20)13(24-8)16-12(21)7(15-14(16)22)4-6-2-1-3-23-6/h1-4,8-11,13,17-20H,5H2,(H,15,22)/b7-4+/t8-,9-,10+,11-,13-/m1/s1 |
| InChIKey | VGTVEHCJBVMBII-OYCZIOPRSA-N |
| XLogP | -2.03 |
| TPSA | 152.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|