C11H15NO6 — CID 101262430
(2R,3R,4R,5S,6R)-3-(furan-2-ylmethylideneamino)-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 101262430) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-3-(furan-2-ylmethylideneamino)-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6R)-3-(furan-2-ylmethylideneamino)-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 101262430 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (2R,3R,4R,5S,6R)-3-(furan-2-ylmethylideneamino)-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](O)[C@H](/N=C/c2ccco2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H15NO6/c13-5-7-9(14)10(15)8(11(16)18-7)12-4-6-2-1-3-17-6/h1-4,7-11,13-16H,5H2/b12-4+/t7-,8-,9-,10-,11-/m1/s1 |
| InChIKey | KCJNUBGUQPOKJD-SOIHDTQHSA-N |
| XLogP | -1.50 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|