C14H19NO7 — CID 136715091
(2R,3R,4R,5S,6R)-3-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 136715091) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-3-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6R)-3-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 136715091 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (2R,3R,4R,5S,6R)-3-[(2-hydroxy-3-methoxyphenyl)methylideneamino]-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | COc1cccc(/C=N/[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]2O)c1O |
| InChI | InChI=1S/C14H19NO7/c1-21-8-4-2-3-7(11(8)17)5-15-10-13(19)12(18)9(6-16)22-14(10)20/h2-5,9-10,12-14,16-20H,6H2,1H3/b15-5+/t9-,10-,12-,13-,14-/m1/s1 |
| InChIKey | WKSFYFVBFIPZJV-FCGGPDHESA-N |
| XLogP | -1.38 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|