C13H16BrNO6 — CID 137279011
(2S,3R,4R,5S,6R)-3-[(5-bromo-2-hydroxyphenyl)methylideneamino]-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 137279011) has the molecular formula C13H16BrNO6 and a molecular weight of 362.18 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-3-[(5-bromo-2-hydroxyphenyl)methylideneamino]-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-3-[(5-bromo-2-hydroxyphenyl)methylideneamino]-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 137279011 |
| Molecular Formula | C13H16BrNO6 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | (2S,3R,4R,5S,6R)-3-[(5-bromo-2-hydroxyphenyl)methylideneamino]-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | OC[C@H]1O[C@H](O)[C@H](/N=C/c2cc(Br)ccc2O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H16BrNO6/c14-7-1-2-8(17)6(3-7)4-15-10-12(19)11(18)9(5-16)21-13(10)20/h1-4,9-13,16-20H,5H2/b15-4+/t9-,10-,11-,12-,13+/m1/s1 |
| InChIKey | ZFFCDISLUXODOF-GQCRBPERSA-N |
| XLogP | -0.63 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|