C14H19NO8 — CID 135964409
(2S,4S)-2-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 135964409) has the molecular formula C14H19NO8 and a molecular weight of 329.31 g/mol. Its IUPAC name is (2S,4S)-2-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,4S)-2-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 135964409 |
| Molecular Formula | C14H19NO8 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (2S,4S)-2-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1cccc(/C=N/O[C@@H]2OC(CO)C(O)[C@H](O)C2O)c1O |
| InChI | InChI=1S/C14H19NO8/c1-21-8-4-2-3-7(10(8)17)5-15-23-14-13(20)12(19)11(18)9(6-16)22-14/h2-5,9,11-14,16-20H,6H2,1H3/b15-5+/t9?,11?,12-,13?,14-/m0/s1 |
| InChIKey | PUBKMQWDLGZHAJ-IJZPZGDQSA-N |
| XLogP | -1.45 |
| TPSA | 141.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|