C22H22O11 — CID 73157249
1,4-dihydroxy-2-methoxy-3-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-9,10-dione (PubChem CID 73157249) has the molecular formula C22H22O11 and a molecular weight of 462.41 g/mol. Its IUPAC name is 1,4-dihydroxy-2-methoxy-3-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-9,10-dione.
| Compound Name | 1,4-dihydroxy-2-methoxy-3-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 73157249 |
| Molecular Formula | C22H22O11 |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 1,4-dihydroxy-2-methoxy-3-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-9,10-dione |
| SMILES | COc1c(C)c(O)c2c(c1O)C(=O)c1cccc(OC3OC(CO)C(O)C(O)C3O)c1C2=O |
| InChI | InChI=1S/C22H22O11/c1-7-14(24)12-13(18(28)21(7)31-2)15(25)8-4-3-5-9(11(8)17(12)27)32-22-20(30)19(29)16(26)10(6-23)33-22/h3-5,10,16,19-20,22-24,26,28-30H,6H2,1-2H3 |
| InChIKey | QOCKEYMCQQIHAO-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|