C20H20N4O4S — CID 1000404
N-[1-[4-(methanesulfonamido)phenyl]ethylideneamino]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 1000404) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[1-[4-(methanesulfonamido)phenyl]ethylideneamino]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[1-[4-(methanesulfonamido)phenyl]ethylideneamino]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 1000404 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-[1-[4-(methanesulfonamido)phenyl]ethylideneamino]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | CC(=NNC(=O)c1c(-c2ccccc2)noc1C)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H20N4O4S/c1-13(15-9-11-17(12-10-15)24-29(3,26)27)21-22-20(25)18-14(2)28-23-19(18)16-7-5-4-6-8-16/h4-12,24H,1-3H3,(H,22,25) |
| InChIKey | ZTXHZHFSQJTYGC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|