C21H19ClN4O3 — CID 5432420
N-[(E)-1-(3-acetamidophenyl)ethylideneamino]-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 5432420) has the molecular formula C21H19ClN4O3 and a molecular weight of 410.86 g/mol. Its IUPAC name is N-[(E)-1-(3-acetamidophenyl)ethylideneamino]-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(E)-1-(3-acetamidophenyl)ethylideneamino]-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 5432420 |
| Molecular Formula | C21H19ClN4O3 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[(E)-1-(3-acetamidophenyl)ethylideneamino]-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CC(=O)Nc1cccc(/C(C)=N/NC(=O)c2c(-c3ccccc3Cl)noc2C)c1 |
| InChI | InChI=1S/C21H19ClN4O3/c1-12(15-7-6-8-16(11-15)23-14(3)27)24-25-21(28)19-13(2)29-26-20(19)17-9-4-5-10-18(17)22/h4-11H,1-3H3,(H,23,27)(H,25,28)/b24-12+ |
| InChIKey | NLVYXUSXGODAPD-WYMPLXKRSA-N |
| XLogP | 4.42 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|