C22H21ClN2O5 — CID 19172143
2-ethoxyethyl 3-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]benzoate (PubChem CID 19172143) has the molecular formula C22H21ClN2O5 and a molecular weight of 428.87 g/mol. Its IUPAC name is 2-ethoxyethyl 3-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]benzoate.
| Compound Name | 2-ethoxyethyl 3-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 19172143 |
| Molecular Formula | C22H21ClN2O5 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-ethoxyethyl 3-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]benzoate |
| SMILES | CCOCCOC(=O)c1cccc(NC(=O)c2c(-c3ccccc3Cl)noc2C)c1 |
| InChI | InChI=1S/C22H21ClN2O5/c1-3-28-11-12-29-22(27)15-7-6-8-16(13-15)24-21(26)19-14(2)30-25-20(19)17-9-4-5-10-18(17)23/h4-10,13H,3,11-12H2,1-2H3,(H,24,26) |
| InChIKey | FSJPPGNFOKXXSD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|