C24H30O5S2 — CID 10004557
[1-(oxan-2-yloxy)-4-phenylsulfanylhex-5-en-2-yl] 4-methylbenzenesulfonate (PubChem CID 10004557) has the molecular formula C24H30O5S2 and a molecular weight of 462.63 g/mol. Its IUPAC name is [1-(oxan-2-yloxy)-4-phenylsulfanylhex-5-en-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-(oxan-2-yloxy)-4-phenylsulfanylhex-5-en-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10004557 |
| Molecular Formula | C24H30O5S2 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | [1-(oxan-2-yloxy)-4-phenylsulfanylhex-5-en-2-yl] 4-methylbenzenesulfonate |
| SMILES | C=CC(CC(COC1CCCCO1)OS(=O)(=O)c1ccc(C)cc1)Sc1ccccc1 |
| InChI | InChI=1S/C24H30O5S2/c1-3-21(30-22-9-5-4-6-10-22)17-20(18-28-24-11-7-8-16-27-24)29-31(25,26)23-14-12-19(2)13-15-23/h3-6,9-10,12-15,20-21,24H,1,7-8,11,16-18H2,2H3 |
| InChIKey | WTLOXJJKLFJJSD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|