C17H17Cl2N5O5S — CID 10005103
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[dichloro-[(S)-(4-methoxyphenyl)sulfinyl]methyl]oxolane-3,4-diol (PubChem CID 10005103) has the molecular formula C17H17Cl2N5O5S and a molecular weight of 474.33 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[dichloro-[(S)-(4-methoxyphenyl)sulfinyl]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[dichloro-[(S)-(4-methoxyphenyl)sulfinyl]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 10005103 |
| Molecular Formula | C17H17Cl2N5O5S |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[dichloro-[(S)-(4-methoxyphenyl)sulfinyl]methyl]oxolane-3,4-diol |
| SMILES | COc1ccc([S@](=O)C(Cl)(Cl)[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C17H17Cl2N5O5S/c1-28-8-2-4-9(5-3-8)30(27)17(18,19)13-11(25)12(26)16(29-13)24-7-23-10-14(20)21-6-22-15(10)24/h2-7,11-13,16,25-26H,1H3,(H2,20,21,22)/t11-,12+,13-,16+,30-/m0/s1 |
| InChIKey | ZBNWHYPZKXTBJC-AQMHXLDDSA-N |
| XLogP | 0.98 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|