C21H22ClN5O7S — CID 10256257
[(2S,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[(S)-chloro-[(S)-(4-methoxyphenyl)sulfinyl]methyl]oxolan-3-yl] acetate (PubChem CID 10256257) has the molecular formula C21H22ClN5O7S and a molecular weight of 523.96 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[(S)-chloro-[(S)-(4-methoxyphenyl)sulfinyl]methyl]oxolan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[(S)-chloro-[(S)-(4-methoxyphenyl)sulfinyl]methyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 10256257 |
| Molecular Formula | C21H22ClN5O7S |
| Molecular Weight | 523.96 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | [(2S,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[(S)-chloro-[(S)-(4-methoxyphenyl)sulfinyl]methyl]oxolan-3-yl] acetate |
| SMILES | COc1ccc([S@](=O)[C@@H](Cl)[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](OC(C)=O)[C@@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C21H22ClN5O7S/c1-10(28)32-15-16(18(22)35(30)13-6-4-12(31-3)5-7-13)34-21(17(15)33-11(2)29)27-9-26-14-19(23)24-8-25-20(14)27/h4-9,15-18,21H,1-3H3,(H2,23,24,25)/t15-,16+,17-,18-,21-,35+/m1/s1 |
| InChIKey | PESUGIKNLBMMJQ-WMXRYYOPSA-N |
| XLogP | 1.55 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.96 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|