C15H20N5O5P — CID 15476927
[(2R,3R,3aR,7aR)-2-(6-aminopurin-9-yl)-5-methoxy-5-oxo-3,3a,4,6,7,7a-hexahydro-2H-phosphinino[4,3-b]furan-3-yl] acetate (PubChem CID 15476927) has the molecular formula C15H20N5O5P and a molecular weight of 381.33 g/mol. Its IUPAC name is [(2R,3R,3aR,7aR)-2-(6-aminopurin-9-yl)-5-methoxy-5-oxo-3,3a,4,6,7,7a-hexahydro-2H-phosphinino[4,3-b]furan-3-yl] acetate.
| Compound Name | [(2R,3R,3aR,7aR)-2-(6-aminopurin-9-yl)-5-methoxy-5-oxo-3,3a,4,6,7,7a-hexahydro-2H-phosphinino[4,3-b]furan-3-yl] acetate |
|---|---|
| PubChem CID | 15476927 |
| Molecular Formula | C15H20N5O5P |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [(2R,3R,3aR,7aR)-2-(6-aminopurin-9-yl)-5-methoxy-5-oxo-3,3a,4,6,7,7a-hexahydro-2H-phosphinino[4,3-b]furan-3-yl] acetate |
| SMILES | COP1(=O)CC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](OC(C)=O)[C@@H]2C1 |
| InChI | InChI=1S/C15H20N5O5P/c1-8(21)24-12-9-5-26(22,23-2)4-3-10(9)25-15(12)20-7-19-11-13(16)17-6-18-14(11)20/h6-7,9-10,12,15H,3-5H2,1-2H3,(H2,16,17,18)/t9-,10-,12-,15-,26?/m1/s1 |
| InChIKey | UBYSJAXJMFDWTK-SOZKRVCHSA-N |
| XLogP | 1.18 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|