C25H23F2N3O5 — CID 10005507
N-[4-[(2,5-dihydroxybenzoyl)amino]cyclohexyl]-5-fluoro-2-(4-fluorophenoxy)pyridine-3-carboxamide (PubChem CID 10005507) has the molecular formula C25H23F2N3O5 and a molecular weight of 483.47 g/mol. Its IUPAC name is N-[4-[(2,5-dihydroxybenzoyl)amino]cyclohexyl]-5-fluoro-2-(4-fluorophenoxy)pyridine-3-carboxamide.
| Compound Name | N-[4-[(2,5-dihydroxybenzoyl)amino]cyclohexyl]-5-fluoro-2-(4-fluorophenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10005507 |
| Molecular Formula | C25H23F2N3O5 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-[4-[(2,5-dihydroxybenzoyl)amino]cyclohexyl]-5-fluoro-2-(4-fluorophenoxy)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCC(NC(=O)c2cc(F)cnc2Oc2ccc(F)cc2)CC1)c1cc(O)ccc1O |
| InChI | InChI=1S/C25H23F2N3O5/c26-14-1-8-19(9-2-14)35-25-21(11-15(27)13-28-25)24(34)30-17-5-3-16(4-6-17)29-23(33)20-12-18(31)7-10-22(20)32/h1-2,7-13,16-17,31-32H,3-6H2,(H,29,33)(H,30,34) |
| InChIKey | XKJIIIMBTGRHEJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|