C26H24FN3O6 — CID 87492957
[4-[[5-fluoro-2-[3-(3-formyl-4-hydroxyphenyl)phenoxy]pyridine-3-carbonyl]amino]cyclohexyl]carbamic acid (PubChem CID 87492957) has the molecular formula C26H24FN3O6 and a molecular weight of 493.49 g/mol. Its IUPAC name is [4-[[5-fluoro-2-[3-(3-formyl-4-hydroxyphenyl)phenoxy]pyridine-3-carbonyl]amino]cyclohexyl]carbamic acid.
| Compound Name | [4-[[5-fluoro-2-[3-(3-formyl-4-hydroxyphenyl)phenoxy]pyridine-3-carbonyl]amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 87492957 |
| Molecular Formula | C26H24FN3O6 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | [4-[[5-fluoro-2-[3-(3-formyl-4-hydroxyphenyl)phenoxy]pyridine-3-carbonyl]amino]cyclohexyl]carbamic acid |
| SMILES | O=Cc1cc(-c2cccc(Oc3ncc(F)cc3C(=O)NC3CCC(NC(=O)O)CC3)c2)ccc1O |
| InChI | InChI=1S/C26H24FN3O6/c27-18-12-22(24(33)29-19-5-7-20(8-6-19)30-26(34)35)25(28-13-18)36-21-3-1-2-15(11-21)16-4-9-23(32)17(10-16)14-31/h1-4,9-14,19-20,30,32H,5-8H2,(H,29,33)(H,34,35) |
| InChIKey | RVKROMIHBKDELH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|