C26H24FN3O5 — CID 87493689
[4-[[5-fluoro-2-[3-(4-formylphenyl)phenoxy]pyridine-3-carbonyl]amino]cyclohexyl]carbamic acid (PubChem CID 87493689) has the molecular formula C26H24FN3O5 and a molecular weight of 477.49 g/mol. Its IUPAC name is [4-[[5-fluoro-2-[3-(4-formylphenyl)phenoxy]pyridine-3-carbonyl]amino]cyclohexyl]carbamic acid.
| Compound Name | [4-[[5-fluoro-2-[3-(4-formylphenyl)phenoxy]pyridine-3-carbonyl]amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 87493689 |
| Molecular Formula | C26H24FN3O5 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | [4-[[5-fluoro-2-[3-(4-formylphenyl)phenoxy]pyridine-3-carbonyl]amino]cyclohexyl]carbamic acid |
| SMILES | O=Cc1ccc(-c2cccc(Oc3ncc(F)cc3C(=O)NC3CCC(NC(=O)O)CC3)c2)cc1 |
| InChI | InChI=1S/C26H24FN3O5/c27-19-13-23(24(32)29-20-8-10-21(11-9-20)30-26(33)34)25(28-14-19)35-22-3-1-2-18(12-22)17-6-4-16(15-31)5-7-17/h1-7,12-15,20-21,30H,8-11H2,(H,29,32)(H,33,34) |
| InChIKey | LNTOBORDHHYQDK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|