C23H34N4O4S2 — CID 10005953
N-[4-[4-[3-(ethylsulfonylamino)phenyl]piperazin-1-yl]butyl]-4-methylbenzenesulfonamide (PubChem CID 10005953) has the molecular formula C23H34N4O4S2 and a molecular weight of 494.68 g/mol. Its IUPAC name is N-[4-[4-[3-(ethylsulfonylamino)phenyl]piperazin-1-yl]butyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-[4-[3-(ethylsulfonylamino)phenyl]piperazin-1-yl]butyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10005953 |
| Molecular Formula | C23H34N4O4S2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | N-[4-[4-[3-(ethylsulfonylamino)phenyl]piperazin-1-yl]butyl]-4-methylbenzenesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cccc(N2CCN(CCCCNS(=O)(=O)c3ccc(C)cc3)CC2)c1 |
| InChI | InChI=1S/C23H34N4O4S2/c1-3-32(28,29)25-21-7-6-8-22(19-21)27-17-15-26(16-18-27)14-5-4-13-24-33(30,31)23-11-9-20(2)10-12-23/h6-12,19,24-25H,3-5,13-18H2,1-2H3 |
| InChIKey | XDOVWNOHIYMNIA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|