About Hydantoin
Hydantoin (PubChem CID 10006) has the molecular formula C3H4N2O2
and a molecular weight of 100.08 g/mol. Its IUPAC name is imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | Hydantoin |
| PubChem CID | 10006 |
| Molecular Formula | C3H4N2O2 |
| Molecular Weight | 100.08 g/mol |
| Exact Mass | 100.03 |
| IUPAC Name | imidazolidine-2,4-dione |
| SMILES | C1C(=O)NC(=O)N1 |
| InChI | InChI=1S/C3H4N2O2/c6-2-1-4-3(7)5-2/h1H2,(H2,4,5,6,7) |
| InChIKey | WJRBRSLFGCUECM-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | 120 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.08 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze Hydantoin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Hydantoin?
The IUPAC name of Hydantoin (CID 10006) is imidazolidine-2,4-dione.
What is the SMILES notation for Hydantoin?
The canonical SMILES for Hydantoin is C1C(=O)NC(=O)N1.
What is the InChIKey of Hydantoin?
The InChIKey is WJRBRSLFGCUECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2/c6-2-1-4-3(7)5-2/h1H2,(H2,4,5,6,7).
What are the key properties of Hydantoin?
Hydantoin has a molecular weight of 100.08 g/mol, XLogP of -1.70, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Hydantoin is sourced from PubChem (CID 10006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).