C26H28N4O7 — CID 10006466
tert-butyl N-[[(19S)-19-ethyl-19-hydroxy-10-methyl-6-oxido-14,18-dioxo-17-oxa-3,13-diaza-6-azoniapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl]methyl]carbamate (PubChem CID 10006466) has the molecular formula C26H28N4O7 and a molecular weight of 508.53 g/mol. Its IUPAC name is tert-butyl N-[[(19S)-19-ethyl-19-hydroxy-10-methyl-6-oxido-14,18-dioxo-17-oxa-3,13-diaza-6-azoniapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(19S)-19-ethyl-19-hydroxy-10-methyl-6-oxido-14,18-dioxo-17-oxa-3,13-diaza-6-azoniapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl]methyl]carbamate |
|---|---|
| PubChem CID | 10006466 |
| Molecular Formula | C26H28N4O7 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | tert-butyl N-[[(19S)-19-ethyl-19-hydroxy-10-methyl-6-oxido-14,18-dioxo-17-oxa-3,13-diaza-6-azoniapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl]methyl]carbamate |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1c[n+]([O-])c(CNC(=O)OC(C)(C)C)cc1c2C |
| InChI | InChI=1S/C26H28N4O7/c1-6-26(34)18-8-20-21-16(10-29(20)22(31)17(18)12-36-23(26)32)13(2)15-7-14(30(35)11-19(15)28-21)9-27-24(33)37-25(3,4)5/h7-8,11,34H,6,9-10,12H2,1-5H3,(H,27,33)/t26-/m0/s1 |
| InChIKey | DLLCWBVHUWXLGR-SANMLTNESA-N |
| XLogP | 2.05 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|