C27H26N4O6 — CID 10391353
tert-butyl N-[3-[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,6,13-triazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl]prop-2-ynyl]carbamate (PubChem CID 10391353) has the molecular formula C27H26N4O6 and a molecular weight of 502.53 g/mol. Its IUPAC name is tert-butyl N-[3-[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,6,13-triazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl]prop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[3-[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,6,13-triazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl]prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 10391353 |
| Molecular Formula | C27H26N4O6 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | tert-butyl N-[3-[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,6,13-triazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl]prop-2-ynyl]carbamate |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(C#CCNC(=O)OC(C)(C)C)ncc3nc2-1 |
| InChI | InChI=1S/C27H26N4O6/c1-5-27(35)19-11-21-22-16(13-31(21)23(32)18(19)14-36-24(27)33)9-15-10-17(29-12-20(15)30-22)7-6-8-28-25(34)37-26(2,3)4/h9-12,35H,5,8,13-14H2,1-4H3,(H,28,34)/t27-/m0/s1 |
| InChIKey | DTAFTOAPFHDFKB-MHZLTWQESA-N |
| XLogP | 2.35 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|