C30H37N3O6Si — CID 142160414
tert-butyl N-[(19S)-5-[dimethyl(propyl)silyl]-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-8-yl]carbamate (PubChem CID 142160414) has the molecular formula C30H37N3O6Si and a molecular weight of 563.73 g/mol. Its IUPAC name is tert-butyl N-[(19S)-5-[dimethyl(propyl)silyl]-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-8-yl]carbamate.
| Compound Name | tert-butyl N-[(19S)-5-[dimethyl(propyl)silyl]-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-8-yl]carbamate |
|---|---|
| PubChem CID | 142160414 |
| Molecular Formula | C30H37N3O6Si |
| Molecular Weight | 563.73 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | tert-butyl N-[(19S)-5-[dimethyl(propyl)silyl]-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-8-yl]carbamate |
| SMILES | CCC[Si](C)(C)c1ccc(NC(=O)OC(C)(C)C)c2cc3c(nc12)-c1cc2c(c(=O)n1C3)COC(=O)[C@]2(O)CC |
| InChI | InChI=1S/C30H37N3O6Si/c1-8-12-40(6,7)23-11-10-21(31-28(36)39-29(3,4)5)18-13-17-15-33-22(24(17)32-25(18)23)14-20-19(26(33)34)16-38-27(35)30(20,37)9-2/h10-11,13-14,37H,8-9,12,15-16H2,1-7H3,(H,31,36)/t30-/m0/s1 |
| InChIKey | BOQDBONFZRIFLI-PMERELPUSA-N |
| XLogP | 4.75 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.73 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|