C26H30N2O5Si — CID 135939733
5-[tert-butyl(dimethyl)silyl]-19-ethyl-8,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione (PubChem CID 135939733) has the molecular formula C26H30N2O5Si and a molecular weight of 478.62 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]-19-ethyl-8,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]-19-ethyl-8,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 135939733 |
| Molecular Formula | C26H30N2O5Si |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]-19-ethyl-8,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c(O)ccc([Si](C)(C)C(C)(C)C)c3nc2-1 |
| InChI | InChI=1S/C26H30N2O5Si/c1-7-26(32)17-11-18-21-14(12-28(18)23(30)16(17)13-33-24(26)31)10-15-19(29)8-9-20(22(15)27-21)34(5,6)25(2,3)4/h8-11,29,32H,7,12-13H2,1-6H3 |
| InChIKey | IQQJHHXQZCZVNI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|