C22H19N3O6 — CID 174370008
2-(8-amino-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-5-yl)acetic acid (PubChem CID 174370008) has the molecular formula C22H19N3O6 and a molecular weight of 421.41 g/mol. Its IUPAC name is 2-(8-amino-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-5-yl)acetic acid.
| Compound Name | 2-(8-amino-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-5-yl)acetic acid |
|---|---|
| PubChem CID | 174370008 |
| Molecular Formula | C22H19N3O6 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-(8-amino-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-5-yl)acetic acid |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c(N)ccc(CC(=O)O)c3nc2-1 |
| InChI | InChI=1S/C22H19N3O6/c1-2-22(30)14-7-16-19-11(8-25(16)20(28)13(14)9-31-21(22)29)5-12-15(23)4-3-10(6-17(26)27)18(12)24-19/h3-5,7,30H,2,6,8-9,23H2,1H3,(H,26,27) |
| InChIKey | BJGFTALGFDNAKF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|