C23H23FN2O4Si — CID 139893634
(19S)-19-ethyl-5-[fluoromethyl(dimethyl)silyl]-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione (PubChem CID 139893634) has the molecular formula C23H23FN2O4Si and a molecular weight of 438.53 g/mol. Its IUPAC name is (19S)-19-ethyl-5-[fluoromethyl(dimethyl)silyl]-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-19-ethyl-5-[fluoromethyl(dimethyl)silyl]-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 139893634 |
| Molecular Formula | C23H23FN2O4Si |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (19S)-19-ethyl-5-[fluoromethyl(dimethyl)silyl]-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cccc([Si](C)(C)CF)c3nc2-1 |
| InChI | InChI=1S/C23H23FN2O4Si/c1-4-23(29)16-9-17-19-14(10-26(17)21(27)15(16)11-30-22(23)28)8-13-6-5-7-18(20(13)25-19)31(2,3)12-24/h5-9,29H,4,10-12H2,1-3H3/t23-/m0/s1 |
| InChIKey | YEMZUFUHNAEWPQ-QHCPKHFHSA-N |
| XLogP | 2.50 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|