C21H16N2O7 — CID 170426266
[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] hydrogen carbonate (PubChem CID 170426266) has the molecular formula C21H16N2O7 and a molecular weight of 408.37 g/mol. Its IUPAC name is [(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] hydrogen carbonate.
| Compound Name | [(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 170426266 |
| Molecular Formula | C21H16N2O7 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | [(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] hydrogen carbonate |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(OC(=O)O)ccc3nc2-1 |
| InChI | InChI=1S/C21H16N2O7/c1-2-21(28)14-7-16-17-11(8-23(16)18(24)13(14)9-29-19(21)25)5-10-6-12(30-20(26)27)3-4-15(10)22-17/h3-7,28H,2,8-9H2,1H3,(H,26,27)/t21-/m0/s1 |
| InChIKey | CYAYLIHMTBLVFS-NRFANRHFSA-N |
| XLogP | 2.14 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|