C29H33N5O7 — CID 58599012
[(19R)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] N-[6-(methylcarbamoylamino)hexyl]carbamate (PubChem CID 58599012) has the molecular formula C29H33N5O7 and a molecular weight of 563.61 g/mol. Its IUPAC name is [(19R)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] N-[6-(methylcarbamoylamino)hexyl]carbamate.
| Compound Name | [(19R)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] N-[6-(methylcarbamoylamino)hexyl]carbamate |
|---|---|
| PubChem CID | 58599012 |
| Molecular Formula | C29H33N5O7 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | [(19R)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] N-[6-(methylcarbamoylamino)hexyl]carbamate |
| SMILES | CC[C@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(OC(=O)NCCCCCCNC(=O)NC)ccc3nc2-1 |
| InChI | InChI=1S/C29H33N5O7/c1-3-29(39)21-14-23-24-18(15-34(23)25(35)20(21)16-40-26(29)36)12-17-13-19(8-9-22(17)33-24)41-28(38)32-11-7-5-4-6-10-31-27(37)30-2/h8-9,12-14,39H,3-7,10-11,15-16H2,1-2H3,(H,32,38)(H2,30,31,37)/t29-/m1/s1 |
| InChIKey | XBTIXGVPJZUHIZ-GDLZYMKVSA-N |
| XLogP | 2.66 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|