C21H15F3N2O7S — CID 14680462
(19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl) trifluoromethanesulfonate (PubChem CID 14680462) has the molecular formula C21H15F3N2O7S and a molecular weight of 496.42 g/mol. Its IUPAC name is (19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl) trifluoromethanesulfonate.
| Compound Name | (19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 14680462 |
| Molecular Formula | C21H15F3N2O7S |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | (19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl) trifluoromethanesulfonate |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(OS(=O)(=O)C(F)(F)F)ccc3nc2-1 |
| InChI | InChI=1S/C21H15F3N2O7S/c1-2-20(29)14-7-16-17-11(8-26(16)18(27)13(14)9-32-19(20)28)5-10-6-12(3-4-15(10)25-17)33-34(30,31)21(22,23)24/h3-7,29H,2,8-9H2,1H3 |
| InChIKey | DXTZDQJYLYFYDL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|