C38H50N2O6 — CID 69402879
[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] 2-heptylundecanoate (PubChem CID 69402879) has the molecular formula C38H50N2O6 and a molecular weight of 630.83 g/mol. Its IUPAC name is [(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] 2-heptylundecanoate.
| Compound Name | [(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] 2-heptylundecanoate |
|---|---|
| PubChem CID | 69402879 |
| Molecular Formula | C38H50N2O6 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.37 |
| IUPAC Name | [(19S)-19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] 2-heptylundecanoate |
| SMILES | CCCCCCCCCC(CCCCCCC)C(=O)Oc1ccc2nc3c(cc2c1)Cn1c-3cc2c(c1=O)COC(=O)[C@]2(O)CC |
| InChI | InChI=1S/C38H50N2O6/c1-4-7-9-11-12-14-16-18-26(17-15-13-10-8-5-2)36(42)46-29-19-20-32-27(22-29)21-28-24-40-33(34(28)39-32)23-31-30(35(40)41)25-45-37(43)38(31,44)6-3/h19-23,26,44H,4-18,24-25H2,1-3H3/t26?,38-/m0/s1 |
| InChIKey | BAMBERHYXYDTDV-OKPNAEFXSA-N |
| XLogP | 8.10 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|