C27H24N4O6 — CID 10051700
N-[2-[(19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl)oxy]ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 10051700) has the molecular formula C27H24N4O6 and a molecular weight of 500.51 g/mol. Its IUPAC name is N-[2-[(19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl)oxy]ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[2-[(19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl)oxy]ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 10051700 |
| Molecular Formula | C27H24N4O6 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | N-[2-[(19-ethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl)oxy]ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(OCCNC(=O)c4ccc[nH]4)ccc3nc2-1 |
| InChI | InChI=1S/C27H24N4O6/c1-2-27(35)19-12-22-23-16(13-31(22)25(33)18(19)14-37-26(27)34)10-15-11-17(5-6-20(15)30-23)36-9-8-29-24(32)21-4-3-7-28-21/h3-7,10-12,28,35H,2,8-9,13-14H2,1H3,(H,29,32) |
| InChIKey | MUNSVZAILUSNRB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|